ChemNet > CAS > 212779-19-6 2,3,5-Trichlorobenzeneboronic acid
212779-19-6 2,3,5-Trichlorobenzeneboronic acid
| उत्पाद का नाम |
2,3,5-Trichlorobenzeneboronic acid |
| समानार्थी |
Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
| आणविक फार्मूला |
C6H4BCl3O2 |
| आण्विक वजन |
225.2648 |
| InChI |
InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| कैस रजिस्टी संख्या |
212779-19-6 |
| आणविक संरचना |
|
| घनत्व |
1.6g/cm3 |
| उबलने का समय |
383.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.594 |
| फ्लैश प्वाइंट |
185.7°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
