ChemNet > CAS > 2131-55-7 4-Chlorophenyl isothiocyanate
2131-55-7 4-Chlorophenyl isothiocyanate
| उत्पाद का नाम |
4-Chlorophenyl isothiocyanate |
| समानार्थी |
Isothiocyanic Acid 4-Chlorophenyl Ester; 1-chloro-4-isothiocyanatobenzene; 4-Chloro-phenylisothiocyanate |
| आणविक फार्मूला |
C7H4ClNS |
| आण्विक वजन |
169.6314 |
| InChI |
InChI=1/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| कैस रजिस्टी संख्या |
2131-55-7 |
| EINECS |
218-358-3 |
| आणविक संरचना |
|
| घनत्व |
1.21g/cm3 |
| गलनांक |
43-136℃ |
| उबलने का समय |
250.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.593 |
| फ्लैश प्वाइंट |
105.1°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
