ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
उत्पाद का नाम |
3-(trifluoromethyl)phenoxyacetonitrile |
समानार्थी |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
आणविक फार्मूला |
C8H7FO3 |
आण्विक वजन |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
कैस रजिस्टी संख्या |
2145-31-5 |
आणविक संरचना |
|
घनत्व |
1.309g/cm3 |
उबलने का समय |
268.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.526 |
फ्लैश प्वाइंट |
116.4°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|