ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
उत्पाद का नाम |
N-(3-Chlorophenyl)urethane |
समानार्थी |
Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
आणविक फार्मूला |
C9H10ClNO2 |
आण्विक वजन |
199.6342 |
InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
कैस रजिस्टी संख्या |
2150-89-2 |
आणविक संरचना |
|
घनत्व |
1.268g/cm3 |
उबलने का समय |
238.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.572 |
फ्लैश प्वाइंट |
98°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|