ChemNet > CAS > 220141-72-0 3,4,5-trifluorobenzyl bromide
220141-72-0 3,4,5-trifluorobenzyl bromide
| उत्पाद का नाम |
3,4,5-trifluorobenzyl bromide |
| समानार्थी |
alpha-Bromo-3,4,5-trifluorotoluene; 5-(bromomethyl)-1,2,3-trifluorobenzene |
| आणविक फार्मूला |
C7H4BrF3 |
| आण्विक वजन |
225.0059 |
| InChI |
InChI=1/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2 |
| कैस रजिस्टी संख्या |
220141-72-0 |
| आणविक संरचना |
|
| घनत्व |
1.71g/cm3 |
| उबलने का समय |
188.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.502 |
| फ्लैश प्वाइंट |
75.1°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
