ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| उत्पाद का नाम |
2-(difluoromethoxy)aniline |
| समानार्थी |
2-Difluoromethoxyaniline |
| आणविक फार्मूला |
C7H7F2NO |
| आण्विक वजन |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| कैस रजिस्टी संख्या |
22236-04-0 |
| आणविक संरचना |
|
| घनत्व |
1.253g/cm3 |
| उबलने का समय |
209.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.501 |
| फ्लैश प्वाइंट |
80.7°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
