ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
उत्पाद का नाम |
5-Bromo-2-methyl-2-pentene |
समानार्थी |
5-bromo-2-methylpent-2-ene |
आणविक फार्मूला |
C6H11Br |
आण्विक वजन |
163.0555 |
InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
कैस रजिस्टी संख्या |
2270-59-9 |
आणविक संरचना |
|
घनत्व |
1.215g/cm3 |
उबलने का समय |
152.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.47 |
फ्लैश प्वाइंट |
22.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|