ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
| उत्पाद का नाम |
Phenanthridine |
| समानार्थी |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| आणविक फार्मूला |
C13H9N |
| आण्विक वजन |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| कैस रजिस्टी संख्या |
229-87-8 |
| EINECS |
205-934-4 |
| आणविक संरचना |
|
| घनत्व |
1.187g/cm3 |
| गलनांक |
104-107℃ |
| उबलने का समय |
340.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.726 |
| फ्लैश प्वाइंट |
155.9°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R40:Possible risks of irreversible effects.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
