ChemNet > CAS > 23165-53-9 4-Chloro-2-methylisothiocyanatobenzene
23165-53-9 4-Chloro-2-methylisothiocyanatobenzene
| उत्पाद का नाम |
4-Chloro-2-methylisothiocyanatobenzene |
| समानार्थी |
4-Chloro-2-methylphenyl isothiocyanate; 4-chloro-1-isothiocyanato-2-methylbenzene |
| आणविक फार्मूला |
C8H6ClNS |
| आण्विक वजन |
183.6579 |
| InChI |
InChI=1/C8H6ClNS/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| कैस रजिस्टी संख्या |
23165-53-9 |
| EINECS |
245-472-0 |
| आणविक संरचना |
|
| घनत्व |
1.18g/cm3 |
| गलनांक |
33℃ |
| उबलने का समय |
275.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.583 |
| फ्लैश प्वाइंट |
120.4°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
