ChemNet > CAS > 23351-07-7 1-(4-Cyanophenyl)-pyrrole
23351-07-7 1-(4-Cyanophenyl)-pyrrole
उत्पाद का नाम |
1-(4-Cyanophenyl)-pyrrole |
समानार्थी |
4-(1H-Pyrrol-1-yl)benzonitrile |
आणविक फार्मूला |
C11H8N2 |
आण्विक वजन |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H |
कैस रजिस्टी संख्या |
23351-07-7 |
आणविक संरचना |
|
घनत्व |
1.05g/cm3 |
उबलने का समय |
312.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.589 |
फ्लैश प्वाइंट |
143°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|