ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
उत्पाद का नाम |
3,4-difluoropropiophenone |
समानार्थी |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
आणविक फार्मूला |
C9H8F2O |
आण्विक वजन |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
कैस रजिस्टी संख्या |
23384-72-7 |
EINECS |
245-627-2 |
आणविक संरचना |
|
घनत्व |
1.166g/cm3 |
उबलने का समय |
225°C at 760 mmHg |
अपवर्तक सूचकांक |
1.472 |
फ्लैश प्वाइंट |
84.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|