ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
उत्पाद का नाम |
Bis-(4-chlorophenylthio)methane |
समानार्थी |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
आणविक फार्मूला |
C13H10Cl2S2 |
आण्विक वजन |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
कैस रजिस्टी संख्या |
2393-97-7 |
आणविक संरचना |
|
घनत्व |
1.38g/cm3 |
गलनांक |
45-48℃ |
उबलने का समय |
420.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.677 |
फ्लैश प्वाइंट |
192.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|