ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
उत्पाद का नाम |
Triallyl Trimellitate |
समानार्थी |
1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
आणविक फार्मूला |
C18H18O6 |
आण्विक वजन |
330.3319 |
InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
कैस रजिस्टी संख्या |
2694-54-4 |
EINECS |
220-264-2 |
आणविक संरचना |
|
घनत्व |
1.149g/cm3 |
उबलने का समय |
438.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.528 |
फ्लैश प्वाइंट |
191.3°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|