CAS No: 3083-10-1, Chemical Name: 1,1,4,7,10,10-hexamethyltriethylene-tetramine
the physical and chemical property of 3083-10-1, 1,1,4,7,10,10-hexamethyltriethylene-tetramine is provided by ChemNet.com
ChemNet > CAS > 3083-10-1 1,1,4,7,10,10-hexamethyltriethylene-tetramine
3083-10-1 1,1,4,7,10,10-hexamethyltriethylene-tetramine
| उत्पाद का नाम |
1,1,4,7,10,10-hexamethyltriethylene-tetramine |
| समानार्थी |
1,1,4,7,10,10-Hexamethyltriethylenetetramine; N~1~,N~1~'-ethane-1,2-diylbis(N~1~,N~2~,N~2~-trimethylethane-1,2-diamine) |
| आणविक फार्मूला |
C12H30N4 |
| आण्विक वजन |
230.3934 |
| InChI |
InChI=1/C12H30N4/c1-13(2)7-9-15(5)11-12-16(6)10-8-14(3)4/h7-12H2,1-6H3 |
| कैस रजिस्टी संख्या |
3083-10-1 |
| EINECS |
221-382-7 |
| आणविक संरचना |
|
| घनत्व |
0.901g/cm3 |
| उबलने का समय |
260.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.479 |
| फ्लैश प्वाइंट |
101.7°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
