ChemNet > CAS > 33018-91-6 Monoethylpimelate
33018-91-6 Monoethylpimelate
| उत्पाद का नाम |
Monoethylpimelate |
| समानार्थी |
Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
| आणविक फार्मूला |
C9H16O4 |
| आण्विक वजन |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| कैस रजिस्टी संख्या |
33018-91-6 |
| EINECS |
251-346-6 |
| आणविक संरचना |
|
| घनत्व |
1.074g/cm3 |
| उबलने का समय |
288.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.449 |
| फ्लैश प्वाइंट |
108°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
