ChemNet > CAS > 3431-62-7 3-nitrobenzaldoxime
3431-62-7 3-nitrobenzaldoxime
| उत्पाद का नाम |
3-nitrobenzaldoxime |
| समानार्थी |
3-Nitrobenzaldoxime, (3-Nitrobenzaldehyde oxime); 3-Nitrobenzaldehyde oxime; N-hydroxy-1-(3-nitrophenyl)methanimine |
| आणविक फार्मूला |
C7H6N2O3 |
| आण्विक वजन |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-8-5-6-2-1-3-7(4-6)9(11)12/h1-5,10H/b8-5- |
| कैस रजिस्टी संख्या |
3431-62-7 |
| आणविक संरचना |
|
| घनत्व |
1.33g/cm3 |
| गलनांक |
123-125℃ |
| उबलने का समय |
295.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.589 |
| फ्लैश प्वाइंट |
132.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
