ChemNet > CAS > 349-01-9 2,4-dinitro-5-fluorotoluene
349-01-9 2,4-dinitro-5-fluorotoluene
| उत्पाद का नाम |
2,4-dinitro-5-fluorotoluene |
| समानार्थी |
1-Fluoro-5-methyl-2,4-dinitrobenzene |
| आणविक फार्मूला |
C7H5FN2O4 |
| आण्विक वजन |
200.124 |
| InChI |
InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| कैस रजिस्टी संख्या |
349-01-9 |
| आणविक संरचना |
|
| घनत्व |
1.497g/cm3 |
| गलनांक |
82℃ |
| उबलने का समय |
319°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.575 |
| फ्लैश प्वाइंट |
146.8°C |
| खतरा प्रतीक |
 T:Toxic;
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
