ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
उत्पाद का नाम |
di(propylene glycol) butyl ether, mixture of |
समानार्थी |
Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
आणविक फार्मूला |
C10H22O3 |
आण्विक वजन |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
कैस रजिस्टी संख्या |
35884-42-5 |
EINECS |
252-776-7 |
आणविक संरचना |
|
घनत्व |
0.931g/cm3 |
उबलने का समय |
221.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.435 |
फ्लैश प्वाइंट |
87.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|