ChemNet > CAS > 35923-79-6 pentafluorophenylisothiocyanate
35923-79-6 pentafluorophenylisothiocyanate
| उत्पाद का नाम |
pentafluorophenylisothiocyanate |
| समानार्थी |
Pentafluorophenyl isothiocyanate; Pentafluoroisothiocyanatobenzene; 1,2,3,4,5-pentafluoro-6-isothiocyanatobenzene |
| आणविक फार्मूला |
C7F5NS |
| आण्विक वजन |
225.1386 |
| InChI |
InChI=1/C7F5NS/c8-2-3(9)5(11)7(13-1-14)6(12)4(2)10 |
| कैस रजिस्टी संख्या |
35923-79-6 |
| EINECS |
252-791-9 |
| आणविक संरचना |
|
| घनत्व |
1.55g/cm3 |
| उबलने का समय |
224.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.492 |
| फ्लैश प्वाइंट |
89.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
