ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
उत्पाद का नाम |
4-Fluoro-1-iodo-2-nitrobenzene |
समानार्थी |
2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
आणविक फार्मूला |
C6H5FN2O2 |
आण्विक वजन |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
कैस रजिस्टी संख्या |
364-77-2 |
EINECS |
206-666-0 |
आणविक संरचना |
|
घनत्व |
1.448g/cm3 |
उबलने का समय |
295.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.603 |
फ्लैश प्वाइंट |
89.4°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|