ChemNet > CAS > 3752-97-4 1,4-bis(Chlormethyl)-2,5-dimethoxybenzene
3752-97-4 1,4-bis(Chlormethyl)-2,5-dimethoxybenzene
उत्पाद का नाम |
1,4-bis(Chlormethyl)-2,5-dimethoxybenzene |
समानार्थी |
d1,4-Bis(chloromethyl)-2,5-dimethoxybenzene; 1,4-Bis(chloromethyl)-2,5-dimethoxybenzene |
आणविक फार्मूला |
C10H12Cl2O2 |
आण्विक वजन |
235.1071 |
InChI |
InChI=1/C10H12Cl2O2/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-4H,5-6H2,1-2H3 |
कैस रजिस्टी संख्या |
3752-97-4 |
आणविक संरचना |
|
घनत्व |
1.219g/cm3 |
गलनांक |
164℃ |
उबलने का समय |
329.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.525 |
फ्लैश प्वाइंट |
126.2°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|