ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
| उत्पाद का नाम |
5-Methyl-2-furanmethanol |
| समानार्थी |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| आणविक फार्मूला |
C6H8O2 |
| आण्विक वजन |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| कैस रजिस्टी संख्या |
3857-25-8 |
| आणविक संरचना |
|
| घनत्व |
1.095g/cm3 |
| उबलने का समय |
178.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.494 |
| फ्लैश प्वाइंट |
61.8°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
