ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
| उत्पाद का नाम |
3,5-Dichlorophenylhydrazine |
| आणविक फार्मूला |
C6H6Cl2N2 |
| आण्विक वजन |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| कैस रजिस्टी संख्या |
39943-56-1 |
| आणविक संरचना |
|
| घनत्व |
1.475g/cm3 |
| उबलने का समय |
286.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.665 |
| फ्लैश प्वाइंट |
126.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
