ChemNet > CAS > 39959-59-6 4-Iodobenzylamine
39959-59-6 4-Iodobenzylamine
उत्पाद का नाम |
4-Iodobenzylamine |
समानार्थी |
4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
आणविक फार्मूला |
C7H8IN |
आण्विक वजन |
233.0496 |
InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
कैस रजिस्टी संख्या |
39959-59-6 |
आणविक संरचना |
|
घनत्व |
1.772g/cm3 |
उबलने का समय |
250.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.644 |
फ्लैश प्वाइंट |
105.2°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|