ChemNet > CAS > 40357-96-8 2-Nitrothiophene-4-carboxylic acid
40357-96-8 2-Nitrothiophene-4-carboxylic acid
| उत्पाद का नाम |
2-Nitrothiophene-4-carboxylic acid |
| समानार्थी |
5-Nitrothiophene-3-carboxylic acid; 5-nitrothiophene-3-carboxylate |
| आणविक फार्मूला |
C5H2NO4S |
| आण्विक वजन |
172.1392 |
| InChI |
InChI=1/C5H3NO4S/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)/p-1 |
| कैस रजिस्टी संख्या |
40357-96-8 |
| आणविक संरचना |
|
| गलनांक |
145-146℃ |
| उबलने का समय |
367.2°C at 760 mmHg |
| फ्लैश प्वाइंट |
175.9°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
