ChemNet > CAS > 4104-75-0 N-methyl-N-phenylthiourea
4104-75-0 N-methyl-N-phenylthiourea
उत्पाद का नाम |
N-methyl-N-phenylthiourea |
समानार्थी |
1-Methyl-1-phenylthiourea |
आणविक फार्मूला |
C8H10N2S |
आण्विक वजन |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
कैस रजिस्टी संख्या |
4104-75-0 |
EINECS |
223-877-3 |
आणविक संरचना |
|
घनत्व |
1.221g/cm3 |
गलनांक |
101℃ |
उबलने का समय |
267.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.679 |
फ्लैश प्वाइंट |
115.3°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S37/39:Wear suitable gloves and eye/face protection.;
|
|