ChemNet > CAS > 42066-86-4 2-isocyanatobenzonitrile
42066-86-4 2-isocyanatobenzonitrile
| उत्पाद का नाम |
2-isocyanatobenzonitrile |
| समानार्थी |
2-Cyanophenyl isocyanate |
| आणविक फार्मूला |
C8H4N2O |
| आण्विक वजन |
144.1302 |
| InChI |
InChI=1/C8H4N2O/c9-5-7-3-1-2-4-8(7)10-6-11/h1-4H |
| कैस रजिस्टी संख्या |
42066-86-4 |
| आणविक संरचना |
|
| घनत्व |
1.09g/cm3 |
| गलनांक |
59℃ |
| उबलने का समय |
266.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.562 |
| फ्लैश प्वाइंट |
114.8°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
