ChemNet > CAS > 42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
उत्पाद का नाम |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
समानार्थी |
(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile; (6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
आणविक फार्मूला |
C10H12N2S |
आण्विक वजन |
192.2807 |
InChI |
InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
कैस रजिस्टी संख्या |
42225-04-7 |
आणविक संरचना |
|
घनत्व |
1.22g/cm3 |
गलनांक |
147℃ |
उबलने का समय |
392.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.607 |
फ्लैश प्वाइंट |
191.4°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|