ChemNet > CAS > 42877-08-7 2-Acetyl-3-bromothiophene
42877-08-7 2-Acetyl-3-bromothiophene
| उत्पाद का नाम |
2-Acetyl-3-bromothiophene |
| समानार्थी |
1-(3-bromothiophen-2-yl)ethanone |
| आणविक फार्मूला |
C6H5BrOS |
| आण्विक वजन |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| कैस रजिस्टी संख्या |
42877-08-7 |
| आणविक संरचना |
|
| घनत्व |
1.619g/cm3 |
| उबलने का समय |
283.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.583 |
| फ्लैश प्वाइंट |
125.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
