ChemNet > CAS > 452-68-6 2-Fluoro-5-Iodotoluene
452-68-6 2-Fluoro-5-Iodotoluene
उत्पाद का नाम |
2-Fluoro-5-Iodotoluene |
आणविक फार्मूला |
C7H6FI |
आण्विक वजन |
236.02 |
InChI |
InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
कैस रजिस्टी संख्या |
452-68-6 |
EINECS |
207-206-1 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|