ChemNet > CAS > 4522-93-4 ethyl pentafluorobenzoate
4522-93-4 ethyl pentafluorobenzoate
| उत्पाद का नाम |
ethyl pentafluorobenzoate |
| समानार्थी |
Pentafluorobenzoic acid ethyl ester |
| आणविक फार्मूला |
C9H5F5O2 |
| आण्विक वजन |
240.12
|
| InChI |
InChI=1/C9H5F5O2/c1-2-16-9(15)3-4(10)6(12)8(14)7(13)5(3)11/h2H2,1H3 |
| कैस रजिस्टी संख्या |
4522-93-4 |
| EINECS |
224-854-0 |
| आणविक संरचना |
|
| घनत्व |
1.431 |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
