ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
उत्पाद का नाम |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
समानार्थी |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
आणविक फार्मूला |
C11H15NO4S |
आण्विक वजन |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
कैस रजिस्टी संख्या |
4815-30-9 |
EINECS |
225-388-0 |
आणविक संरचना |
|
घनत्व |
1.247g/cm3 |
गलनांक |
103-108℃ |
उबलने का समय |
372.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.558 |
फ्लैश प्वाइंट |
179.1°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|