ChemNet > CAS > 499771-20-9 2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione
499771-20-9 2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione
| उत्पाद का नाम |
2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| समानार्थी |
2-(morpholin-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| आणविक फार्मूला |
C13H14N2O3 |
| आण्विक वजन |
246.2619 |
| InChI |
InChI=1/C13H14N2O3/c16-12-10-3-1-2-4-11(10)13(17)15(12)8-9-7-14-5-6-18-9/h1-4,9,14H,5-8H2 |
| कैस रजिस्टी संख्या |
499771-20-9 |
| आणविक संरचना |
|
| घनत्व |
1.297g/cm3 |
| गलनांक |
141℃ |
| उबलने का समय |
407.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.586 |
| फ्लैश प्वाइंट |
200.4°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
