ChemNet > CAS > 5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
उत्पाद का नाम |
2-amino-4,5-dimethyl-3-furancarbonitrile |
समानार्थी |
2-Amino-4,5-dimethyl-3-furonitrile; 2-amino-4,5-dimethylfuran-3-carbonitrile |
आणविक फार्मूला |
C7H8N2O |
आण्विक वजन |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-4-5(2)10-7(9)6(4)3-8/h9H2,1-2H3 |
कैस रजिस्टी संख्या |
5117-88-4 |
आणविक संरचना |
|
घनत्व |
1.15g/cm3 |
गलनांक |
163-169℃ |
उबलने का समय |
287.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.535 |
फ्लैश प्वाइंट |
127.8°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|