ChemNet > CAS > 51788-80-8 4-Fluoro-2-methoxyacetophenone
51788-80-8 4-Fluoro-2-methoxyacetophenone
उत्पाद का नाम |
4-Fluoro-2-methoxyacetophenone |
समानार्थी |
2'-methoxy-4'-fluoroacetophenone; 4'-Fluoro-2'-methoxyacetophenone |
आणविक फार्मूला |
C9H9FO2 |
आण्विक वजन |
168.16 |
InChI |
InChI=1/C9H9FO2/c1-6(11)8-4-3-7(10)5-9(8)12-2/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
51788-80-8 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|