ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
उत्पाद का नाम |
2,5-Dibromo-3,4-dinitrothiophene |
समानार्थी |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
आणविक फार्मूला |
C4Br2N2O4S |
आण्विक वजन |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
कैस रजिस्टी संख्या |
52431-30-8 |
आणविक संरचना |
|
घनत्व |
2.459g/cm3 |
उबलने का समय |
341.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.716 |
फ्लैश प्वाइंट |
160.2°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|