ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
| उत्पाद का नाम |
2,5-Dibromo-3,4-dinitrothiophene |
| समानार्थी |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| आणविक फार्मूला |
C4Br2N2O4S |
| आण्विक वजन |
331.9268 |
| InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| कैस रजिस्टी संख्या |
52431-30-8 |
| आणविक संरचना |
|
| घनत्व |
2.459g/cm3 |
| उबलने का समय |
341.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.716 |
| फ्लैश प्वाइंट |
160.2°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
