| उत्पाद का नाम |
Gluconic acid |
| समानार्थी |
D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); Gluconic Acid Solution |
| आणविक फार्मूला |
C6H11O7 |
| आण्विक वजन |
195.1479 |
| InChI |
InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
| कैस रजिस्टी संख्या |
526-95-4 |
| EINECS |
208-401-4 |
| आणविक संरचना |
|
| गलनांक |
15℃ |
| उबलने का समय |
673.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
375.1°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
