ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| उत्पाद का नाम |
Hexaketocyclohexane octahydrate |
| समानार्थी |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| आणविक फार्मूला |
C6H16O14 |
| आण्विक वजन |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| कैस रजिस्टी संख्या |
527-31-1 |
| EINECS |
208-412-4 |
| आणविक संरचना |
|
| गलनांक |
90-93℃ |
| उबलने का समय |
344.7°C at 760 mmHg |
| फ्लैश प्वाइंट |
152°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21:Harmful by inhalation and in contact with skin.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
