ChemNet > CAS > 53001-74-4 2,3,4,5-Tetrafluorophenylacetonitrile
53001-74-4 2,3,4,5-Tetrafluorophenylacetonitrile
उत्पाद का नाम |
2,3,4,5-Tetrafluorophenylacetonitrile |
समानार्थी |
2,3,4,5-Tetrafluorobenzyl cyanide |
आणविक फार्मूला |
C8H3F4N |
आण्विक वजन |
189.1097 |
InChI |
InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2 |
कैस रजिस्टी संख्या |
53001-74-4 |
आणविक संरचना |
|
घनत्व |
1.427g/cm3 |
उबलने का समय |
208.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.451 |
फ्लैश प्वाइंट |
103.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|