ChemNet > CAS > 5414-99-3 Glutaranilic Acid
5414-99-3 Glutaranilic Acid
| उत्पाद का नाम |
Glutaranilic Acid |
| समानार्थी |
N-Phenylglutaramic Acid; Pentanedioic acid mono(N-phenyl)amide; 5-oxo-5-(phenylamino)pentanoic acid; 5-oxo-5-(phenylamino)pentanoate |
| आणविक फार्मूला |
C11H12NO3 |
| आण्विक वजन |
206.2184 |
| InChI |
InChI=1/C11H13NO3/c13-10(7-4-8-11(14)15)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)(H,14,15)/p-1 |
| कैस रजिस्टी संख्या |
5414-99-3 |
| आणविक संरचना |
|
| उबलने का समय |
478.5°C at 760 mmHg |
| फ्लैश प्वाइंट |
243.2°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
