ChemNet > CAS > 5445-22-7 Methyl 2-bromooctanoate
5445-22-7 Methyl 2-bromooctanoate
उत्पाद का नाम |
Methyl 2-bromooctanoate |
समानार्थी |
2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
आणविक फार्मूला |
C9H17BrO2 |
आण्विक वजन |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
कैस रजिस्टी संख्या |
5445-22-7 |
EINECS |
226-644-4 |
आणविक संरचना |
|
घनत्व |
1.221g/cm3 |
उबलने का समय |
227.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.46 |
फ्लैश प्वाइंट |
101.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|