ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| उत्पाद का नाम |
3-Methylthiophene-2-carbonitrile |
| समानार्थी |
2-Cyano-3-methylthiophene |
| आणविक फार्मूला |
C6H5NS |
| आण्विक वजन |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| कैस रजिस्टी संख्या |
55406-13-8 |
| आणविक संरचना |
|
| घनत्व |
1.16g/cm3 |
| उबलने का समय |
212.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.556 |
| फ्लैश प्वाइंट |
82.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
