ChemNet > CAS > 555-90-8 Nicothiazone
555-90-8 Nicothiazone
| उत्पाद का नाम |
Nicothiazone |
| समानार्थी |
3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
| आणविक फार्मूला |
C7H8N4S |
| आण्विक वजन |
180.2302 |
| InChI |
InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
| कैस रजिस्टी संख्या |
555-90-8 |
| EINECS |
209-108-4 |
| आणविक संरचना |
|
| घनत्व |
1.32g/cm3 |
| उबलने का समय |
346.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.665 |
| फ्लैश प्वाइंट |
163.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R25:Toxic if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
