ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
| उत्पाद का नाम |
1,5-Dimethyl-2-pyrrolecarbonitrile |
| समानार्थी |
1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
| आणविक फार्मूला |
C7H8N2 |
| आण्विक वजन |
120.1518 |
| InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
| कैस रजिस्टी संख्या |
56341-36-7 |
| EINECS |
260-120-6 |
| आणविक संरचना |
|
| घनत्व |
0.98g/cm3 |
| गलनांक |
53-56℃ |
| उबलने का समय |
238.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.529 |
| फ्लैश प्वाइंट |
104.4°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21:Harmful by inhalation and in contact with skin.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
