ChemNet > CAS > 589-82-2 3-Heptanol
589-82-2 3-Heptanol
| उत्पाद का नाम |
3-Heptanol |
| समानार्थी |
heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| आणविक फार्मूला |
C7H16O |
| आण्विक वजन |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| कैस रजिस्टी संख्या |
589-82-2 |
| EINECS |
209-661-1 |
| आणविक संरचना |
|
| घनत्व |
0.818g/cm3 |
| गलनांक |
-70℃ |
| उबलने का समय |
156.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.42 |
| फ्लैश प्वाइंट |
54.4°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
