ChemNet > CAS > 59918-68-2 3-furancarbothioamide
59918-68-2 3-furancarbothioamide
| उत्पाद का नाम |
3-furancarbothioamide |
| समानार्थी |
furan-3-carbothioamide |
| आणविक फार्मूला |
C5H5NOS |
| आण्विक वजन |
127.1643 |
| InChI |
InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| कैस रजिस्टी संख्या |
59918-68-2 |
| आणविक संरचना |
|
| घनत्व |
1.287g/cm3 |
| गलनांक |
74℃ |
| उबलने का समय |
219.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.62 |
| फ्लैश प्वाइंट |
86.6°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
