ChemNet > CAS > 60404-18-4 3-Bromo-2,5-dichlorothiophene
60404-18-4 3-Bromo-2,5-dichlorothiophene
| उत्पाद का नाम |
3-Bromo-2,5-dichlorothiophene |
| आणविक फार्मूला |
C4HBrCl2S |
| आण्विक वजन |
231.9257 |
| InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| कैस रजिस्टी संख्या |
60404-18-4 |
| आणविक संरचना |
|
| घनत्व |
1.949g/cm3 |
| उबलने का समय |
223.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.625 |
| फ्लैश प्वाइंट |
88.7°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
