ChemNet > CAS > 624-39-5 1,4-Benzenedithiol
624-39-5 1,4-Benzenedithiol
उत्पाद का नाम |
1,4-Benzenedithiol |
समानार्थी |
1,4-Dimercaptobenzene; Dithiohydroquinone; benzene-1,4-dithiol; benzene-1,4-bis(thiolate) |
आणविक फार्मूला |
C6H4S2 |
आण्विक वजन |
140.2271 |
InChI |
InChI=1/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
कैस रजिस्टी संख्या |
624-39-5 |
आणविक संरचना |
|
उबलने का समय |
243.3°C at 760 mmHg |
फ्लैश प्वाइंट |
111.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|