ChemNet > CAS > 625-33-2 3-penten-2-one
625-33-2 3-penten-2-one
| उत्पाद का नाम |
3-penten-2-one |
| समानार्थी |
ethylideneacetone; pent-3-en-2-one; (3E)-pent-3-en-2-one; (3Z)-pent-3-en-2-one |
| आणविक फार्मूला |
C5H8O |
| आण्विक वजन |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3- |
| कैस रजिस्टी संख्या |
625-33-2 |
| EINECS |
210-888-3 |
| आणविक संरचना |
|
| घनत्व |
0.826g/cm3 |
| उबलने का समय |
122°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.411 |
| फ्लैश प्वाइंट |
19.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R36/37:Irritating to eyes and respiratory system.;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
