ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
उत्पाद का नाम |
2-Nitroethanol |
समानार्थी |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
आणविक फार्मूला |
C2H5NO3 |
आण्विक वजन |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
कैस रजिस्टी संख्या |
625-48-9 |
EINECS |
210-895-1 |
आणविक संरचना |
|
घनत्व |
1.267g/cm3 |
उबलने का समय |
193.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.438 |
फ्लैश प्वाइंट |
113.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|